C23H21F2N5O — CID 135287295
2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpyrimidine-4-carboxamide (PubChem CID 135287295) has the molecular formula C23H21F2N5O and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpyrimidine-4-carboxamide.
| Compound Name | 2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135287295 |
| Molecular Formula | C23H21F2N5O |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1ccnc([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C23H21F2N5O/c1-22(2)13-7-9-23(22,21-27-10-8-16(28-21)20(31)26-3)19-12(13)11-17(29-30-19)18-14(24)5-4-6-15(18)25/h4-6,8,10-11,13H,7,9H2,1-3H3,(H,26,31)/t13-,23+/m0/s1 |
| InChIKey | WOWDXJWHUQAQPA-ZAMGYDSWSA-N |
| XLogP | 3.77 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |