C27H27F2N5O2 — CID 135287808
6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(3-hydroxy-3-methylcyclobutyl)pyrazine-2-carboxamide (PubChem CID 135287808) has the molecular formula C27H27F2N5O2 and a molecular weight of 491.54 g/mol. Its IUPAC name is 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(3-hydroxy-3-methylcyclobutyl)pyrazine-2-carboxamide.
| Compound Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(3-hydroxy-3-methylcyclobutyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135287808 |
| Molecular Formula | C27H27F2N5O2 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(3-hydroxy-3-methylcyclobutyl)pyrazine-2-carboxamide |
| SMILES | CC1(O)CC(NC(=O)c2cncc([C@@]34CC[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)C1 |
| InChI | InChI=1S/C27H27F2N5O2/c1-25(2)16-7-8-27(25,21-13-30-12-20(32-21)24(35)31-14-10-26(3,36)11-14)23-15(16)9-19(33-34-23)22-17(28)5-4-6-18(22)29/h4-6,9,12-14,16,36H,7-8,10-11H2,1-3H3,(H,31,35)/t14?,16-,26?,27-/m0/s1 |
| InChIKey | LUOCGCFPHIUVEP-YJXBNQPNSA-N |
| XLogP | 4.06 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |