C26H26F2N4O2 — CID 160708875
1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-methoxybutan-1-one (PubChem CID 160708875) has the molecular formula C26H26F2N4O2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 160708875 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1cncc([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C26H26F2N4O2/c1-25(2)16-9-10-26(25,22-14-29-13-20(30-22)21(33)8-5-11-34-3)24-15(16)12-19(31-32-24)23-17(27)6-4-7-18(23)28/h4,6-7,12-14,16H,5,8-11H2,1-3H3/t16-,26-/m0/s1 |
| InChIKey | RROYQAVDUQTNEK-QMTYFTJSSA-N |
| XLogP | 5.02 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|