C26H23F2N7O — CID 135287816
2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetamide (PubChem CID 135287816) has the molecular formula C26H23F2N7O and a molecular weight of 487.51 g/mol. Its IUPAC name is 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 135287816 |
| Molecular Formula | C26H23F2N7O |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(-c3cnn(CC(N)=O)c3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H23F2N7O/c1-25(2)16-6-7-26(25,21-11-30-10-20(32-21)14-9-31-35(12-14)13-22(29)36)24-15(16)8-19(33-34-24)23-17(27)4-3-5-18(23)28/h3-5,8-12,16H,6-7,13H2,1-2H3,(H2,29,36)/t16-,26-/m0/s1 |
| InChIKey | YGYXNGWJIDBIRO-QMTYFTJSSA-N |
| XLogP | 3.76 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |