C28H27F2N5O2S — CID 139432141
(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 139432141) has the molecular formula C28H27F2N5O2S and a molecular weight of 535.62 g/mol. Its IUPAC name is (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 139432141 |
| Molecular Formula | C28H27F2N5O2S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | (1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-[1-(2-methylsulfonylethyl)pyrazol-4-yl]-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@@]1(c1cccc(-c3cnn(CCS(C)(=O)=O)c3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C28H27F2N5O2S/c1-27(2)19-10-11-28(27,26-18(19)14-23(33-34-26)25-20(29)6-4-7-21(25)30)24-9-5-8-22(32-24)17-15-31-35(16-17)12-13-38(3,36)37/h4-9,14-16,19H,10-13H2,1-3H3/t19-,28+/m0/s1 |
| InChIKey | WJFJKTPSTUMERJ-HMILPKGGSA-N |
| XLogP | 4.93 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |