C24H20F2N6O — CID 135287683
N-(cyanomethyl)-6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazine-2-carboxamide (PubChem CID 135287683) has the molecular formula C24H20F2N6O and a molecular weight of 446.46 g/mol. Its IUPAC name is N-(cyanomethyl)-6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazine-2-carboxamide.
| Compound Name | N-(cyanomethyl)-6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135287683 |
| Molecular Formula | C24H20F2N6O |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(cyanomethyl)-6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(C(=O)NCC#N)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H20F2N6O/c1-23(2)14-6-7-24(23,19-12-28-11-18(30-19)22(33)29-9-8-27)21-13(14)10-17(31-32-21)20-15(25)4-3-5-16(20)26/h3-5,10-12,14H,6-7,9H2,1-2H3,(H,29,33)/t14-,24-/m0/s1 |
| InChIKey | OOWMMYGANHTVQO-BSEYFRJRSA-N |
| XLogP | 3.67 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|