C25H23F2N7O — CID 135287697
2-[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-1,2,4-triazol-1-yl]ethanol (PubChem CID 135287697) has the molecular formula C25H23F2N7O and a molecular weight of 475.50 g/mol. Its IUPAC name is 2-[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 2-[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 135287697 |
| Molecular Formula | C25H23F2N7O |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-[5-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]-1,2,4-triazol-1-yl]ethanol |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(-c3ncnn3CCO)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H23F2N7O/c1-24(2)15-6-7-25(24,20-12-28-11-19(31-20)23-29-13-30-34(23)8-9-35)22-14(15)10-18(32-33-22)21-16(26)4-3-5-17(21)27/h3-5,10-13,15,35H,6-9H2,1-2H3/t15-,25-/m0/s1 |
| InChIKey | KCRTVYPNKIHABR-MQNRADLISA-N |
| XLogP | 3.67 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |