C25H22F2N6O — CID 135287320
[1-[6-[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-3-yl]methanol (PubChem CID 135287320) has the molecular formula C25H22F2N6O and a molecular weight of 460.49 g/mol. Its IUPAC name is [1-[6-[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-3-yl]methanol.
| Compound Name | [1-[6-[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 135287320 |
| Molecular Formula | C25H22F2N6O |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [1-[6-[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-3-yl]methanol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(c1cncc(-n3ccc(CO)n3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H22F2N6O/c1-24(2)16-6-8-25(24,20-11-28-12-21(29-20)33-9-7-14(13-34)32-33)23-15(16)10-19(30-31-23)22-17(26)4-3-5-18(22)27/h3-5,7,9-12,16,34H,6,8,13H2,1-2H3/t16-,25-/m1/s1 |
| InChIKey | OCLUAHXQULIWMM-PUAOIOHZSA-N |
| XLogP | 4.09 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |