C26H23F3N6 — CID 162015781
(1S,8R)-5-(2,6-difluorophenyl)-1-[2-(3-ethylpyrazol-1-yl)-5-fluoropyrimidin-4-yl]-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 162015781) has the molecular formula C26H23F3N6 and a molecular weight of 476.51 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-1-[2-(3-ethylpyrazol-1-yl)-5-fluoropyrimidin-4-yl]-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-1-[2-(3-ethylpyrazol-1-yl)-5-fluoropyrimidin-4-yl]-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 162015781 |
| Molecular Formula | C26H23F3N6 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-1-[2-(3-ethylpyrazol-1-yl)-5-fluoropyrimidin-4-yl]-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CCc1ccn(-c2ncc(F)c([C@@]34CC[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)n1 |
| InChI | InChI=1S/C26H23F3N6/c1-4-14-9-11-35(34-14)24-30-13-19(29)23(31-24)26-10-8-16(25(26,2)3)15-12-20(32-33-22(15)26)21-17(27)6-5-7-18(21)28/h5-7,9,11-13,16H,4,8,10H2,1-3H3/t16-,26+/m0/s1 |
| InChIKey | BATIBEXKHYWVKC-YHAMSUFESA-N |
| XLogP | 5.30 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |