C22H16ClF2N5 — CID 135287396
5-chloro-4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidine-2-carbonitrile (PubChem CID 135287396) has the molecular formula C22H16ClF2N5 and a molecular weight of 423.85 g/mol. Its IUPAC name is 5-chloro-4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidine-2-carbonitrile.
| Compound Name | 5-chloro-4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 135287396 |
| Molecular Formula | C22H16ClF2N5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 5-chloro-4-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrimidine-2-carbonitrile |
| SMILES | CC1(C)[C@H]2CC[C@@]1(c1nc(C#N)ncc1Cl)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H16ClF2N5/c1-21(2)12-6-7-22(21,20-13(23)10-27-17(9-26)28-20)19-11(12)8-16(29-30-19)18-14(24)4-3-5-15(18)25/h3-5,8,10,12H,6-7H2,1-2H3/t12-,22-/m0/s1 |
| InChIKey | KGDUSSNAMSWNIJ-YTEVENLXSA-N |
| XLogP | 4.94 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |