C23H16F2N6 — CID 153426761
5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-isocyanopyrazine-2-carbonitrile (PubChem CID 153426761) has the molecular formula C23H16F2N6 and a molecular weight of 414.42 g/mol. Its IUPAC name is 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-isocyanopyrazine-2-carbonitrile.
| Compound Name | 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-isocyanopyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 153426761 |
| Molecular Formula | C23H16F2N6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-isocyanopyrazine-2-carbonitrile |
| SMILES | [C-]#[N+]c1nc(C23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)cnc1C#N |
| InChI | InChI=1S/C23H16F2N6/c1-22(2)13-7-8-23(22,18-11-28-17(10-26)21(27-3)29-18)20-12(13)9-16(30-31-20)19-14(24)5-4-6-15(19)25/h4-6,9,11,13H,7-8H2,1-2H3/t13-,23?/m0/s1 |
| InChIKey | AWCJCCQBVQLJAH-AVEISGIFSA-N |
| XLogP | 4.84 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|