C22H18F3N3 — CID 135297867
(8R)-5-(2,6-difluorophenyl)-1-(5-fluoro-3-pyridinyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 135297867) has the molecular formula C22H18F3N3 and a molecular weight of 381.40 g/mol. Its IUPAC name is (8R)-5-(2,6-difluorophenyl)-1-(5-fluoro-3-pyridinyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (8R)-5-(2,6-difluorophenyl)-1-(5-fluoro-3-pyridinyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 135297867 |
| Molecular Formula | C22H18F3N3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (8R)-5-(2,6-difluorophenyl)-1-(5-fluoro-3-pyridinyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CCC1(c1cncc(F)c1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H18F3N3/c1-21(2)15-6-7-22(21,12-8-13(23)11-26-10-12)20-14(15)9-18(27-28-20)19-16(24)4-3-5-17(19)25/h3-5,8-11,15H,6-7H2,1-2H3/t15-,22?/m0/s1 |
| InChIKey | RMYOZDTWGWVVTQ-UEDXYCIISA-N |
| XLogP | 5.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |