C29H28F2N6OS — CID 159091527
3-[[1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-1-methylidenethietane 1-oxide (PubChem CID 159091527) has the molecular formula C29H28F2N6OS and a molecular weight of 546.65 g/mol. Its IUPAC name is 3-[[1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-1-methylidenethietane 1-oxide.
| Compound Name | 3-[[1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-1-methylidenethietane 1-oxide |
|---|---|
| PubChem CID | 159091527 |
| Molecular Formula | C29H28F2N6OS |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 3-[[1-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-1-methylidenethietane 1-oxide |
| SMILES | C=S1(=O)CC(Cc2ncn(-c3cccc([C@@]45CC[C@@H](c6cc(-c7c(F)cccc7F)nnc64)C5(C)C)n3)n2)C1 |
| InChI | InChI=1S/C29H28F2N6OS/c1-28(2)19-10-11-29(28,27-18(19)13-22(34-35-27)26-20(30)6-4-7-21(26)31)23-8-5-9-25(33-23)37-16-32-24(36-37)12-17-14-39(3,38)15-17/h4-9,13,16-17,19H,3,10-12,14-15H2,1-2H3/t17?,19-,29-,39?/m0/s1 |
| InChIKey | SNAIYFAMWSAAJQ-LKJTYSDMSA-N |
| XLogP | 4.49 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|