C26H36O5 — CID 135297927
decyl 3-(hydroxymethyl)-4-(2-phenoxyethoxy)benzoate (PubChem CID 135297927) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is decyl 3-(hydroxymethyl)-4-(2-phenoxyethoxy)benzoate.
| Compound Name | decyl 3-(hydroxymethyl)-4-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 135297927 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | decyl 3-(hydroxymethyl)-4-(2-phenoxyethoxy)benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(OCCOc2ccccc2)c(CO)c1 |
| InChI | InChI=1S/C26H36O5/c1-2-3-4-5-6-7-8-12-17-31-26(28)22-15-16-25(23(20-22)21-27)30-19-18-29-24-13-10-9-11-14-24/h9-11,13-16,20,27H,2-8,12,17-19,21H2,1H3 |
| InChIKey | XVAFDVXVKDYZOQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|