C17H14F2N4O3S — CID 135298542
3-fluoro-N'-(2-fluorophenyl)sulfonyl-5-(3-methylpyrazol-1-yl)benzohydrazide (PubChem CID 135298542) has the molecular formula C17H14F2N4O3S and a molecular weight of 392.39 g/mol. Its IUPAC name is 3-fluoro-N'-(2-fluorophenyl)sulfonyl-5-(3-methylpyrazol-1-yl)benzohydrazide.
| Compound Name | 3-fluoro-N'-(2-fluorophenyl)sulfonyl-5-(3-methylpyrazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 135298542 |
| Molecular Formula | C17H14F2N4O3S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-fluoro-N'-(2-fluorophenyl)sulfonyl-5-(3-methylpyrazol-1-yl)benzohydrazide |
| SMILES | Cc1ccn(-c2cc(F)cc(C(=O)NNS(=O)(=O)c3ccccc3F)c2)n1 |
| InChI | InChI=1S/C17H14F2N4O3S/c1-11-6-7-23(21-11)14-9-12(8-13(18)10-14)17(24)20-22-27(25,26)16-5-3-2-4-15(16)19/h2-10,22H,1H3,(H,20,24) |
| InChIKey | LHSITODGOANROC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|