C13H28O5S — CID 135302058
2-[3-[3-(2-hydroxyethoxy)-2-methyl-2-sulfanylpropoxy]-2,2-dimethylpropoxy]ethanol (PubChem CID 135302058) has the molecular formula C13H28O5S and a molecular weight of 296.43 g/mol. Its IUPAC name is 2-[3-[3-(2-hydroxyethoxy)-2-methyl-2-sulfanylpropoxy]-2,2-dimethylpropoxy]ethanol.
| Compound Name | 2-[3-[3-(2-hydroxyethoxy)-2-methyl-2-sulfanylpropoxy]-2,2-dimethylpropoxy]ethanol |
|---|---|
| PubChem CID | 135302058 |
| Molecular Formula | C13H28O5S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[3-[3-(2-hydroxyethoxy)-2-methyl-2-sulfanylpropoxy]-2,2-dimethylpropoxy]ethanol |
| SMILES | CC(C)(COCCO)COCC(C)(S)COCCO |
| InChI | InChI=1S/C13H28O5S/c1-12(2,8-16-6-4-14)9-18-11-13(3,19)10-17-7-5-15/h14-15,19H,4-11H2,1-3H3 |
| InChIKey | FFGQKYWRUAKKJG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|