C14H31NO8 — CID 87314889
1-[2-(2-hydroxyethoxy)ethoxy]-2-[[2-hydroxy-1-[2-(2-hydroxyethoxy)ethoxy]propan-2-yl]amino]propan-2-ol (PubChem CID 87314889) has the molecular formula C14H31NO8 and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]-2-[[2-hydroxy-1-[2-(2-hydroxyethoxy)ethoxy]propan-2-yl]amino]propan-2-ol.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-[[2-hydroxy-1-[2-(2-hydroxyethoxy)ethoxy]propan-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 87314889 |
| Molecular Formula | C14H31NO8 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]-2-[[2-hydroxy-1-[2-(2-hydroxyethoxy)ethoxy]propan-2-yl]amino]propan-2-ol |
| SMILES | CC(O)(COCCOCCO)NC(C)(O)COCCOCCO |
| InChI | InChI=1S/C14H31NO8/c1-13(18,11-22-9-7-20-5-3-16)15-14(2,19)12-23-10-8-21-6-4-17/h15-19H,3-12H2,1-2H3 |
| InChIKey | YYETYPXXNXTEMC-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|