C18H38O11 — CID 140726713
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1,1-dimethoxyethanol (PubChem CID 140726713) has the molecular formula C18H38O11 and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1,1-dimethoxyethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1,1-dimethoxyethanol |
|---|---|
| PubChem CID | 140726713 |
| Molecular Formula | C18H38O11 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1,1-dimethoxyethanol |
| SMILES | COC(O)(COCCOCCOCCOCCOCCOCCOCCO)OC |
| InChI | InChI=1S/C18H38O11/c1-21-18(20,22-2)17-29-16-15-28-14-13-27-12-11-26-10-9-25-8-7-24-6-5-23-4-3-19/h19-20H,3-17H2,1-2H3 |
| InChIKey | BHYIFMSTDGRWKT-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|