C29H30N2O4S — CID 135302339
[4-(2-hydroxy-2-methoxy-1-phenylethyl)piperidin-1-yl]-[3-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]methanone (PubChem CID 135302339) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is [4-(2-hydroxy-2-methoxy-1-phenylethyl)piperidin-1-yl]-[3-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]methanone.
| Compound Name | [4-(2-hydroxy-2-methoxy-1-phenylethyl)piperidin-1-yl]-[3-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 135302339 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [4-(2-hydroxy-2-methoxy-1-phenylethyl)piperidin-1-yl]-[3-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]methanone |
| SMILES | COc1ccc2nc(-c3cccc(C(=O)N4CCC(C(c5ccccc5)C(O)OC)CC4)c3)sc2c1 |
| InChI | InChI=1S/C29H30N2O4S/c1-34-23-11-12-24-25(18-23)36-27(30-24)21-9-6-10-22(17-21)28(32)31-15-13-20(14-16-31)26(29(33)35-2)19-7-4-3-5-8-19/h3-12,17-18,20,26,29,33H,13-16H2,1-2H3 |
| InChIKey | CHBIYARAJYLOSJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|