C30H31N3O4S — CID 146404562
benzyl 4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidine-1-carboxylate (PubChem CID 146404562) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is benzyl 4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 146404562 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | benzyl 4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidine-1-carboxylate |
| SMILES | COc1ccc2nc(-c3ccc(N4CC(OC5CCN(C(=O)OCc6ccccc6)CC5)C4)cc3)sc2c1 |
| InChI | InChI=1S/C30H31N3O4S/c1-35-25-11-12-27-28(17-25)38-29(31-27)22-7-9-23(10-8-22)33-18-26(19-33)37-24-13-15-32(16-14-24)30(34)36-20-21-5-3-2-4-6-21/h2-12,17,24,26H,13-16,18-20H2,1H3 |
| InChIKey | MDBSYIOWBVCDQT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|