C26H35N5O2S — CID 146420449
N'-[2-[4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidin-1-yl]ethyl]ethane-1,2-diamine (PubChem CID 146420449) has the molecular formula C26H35N5O2S and a molecular weight of 481.67 g/mol. Its IUPAC name is N'-[2-[4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidin-1-yl]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidin-1-yl]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 146420449 |
| Molecular Formula | C26H35N5O2S |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N'-[2-[4-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypiperidin-1-yl]ethyl]ethane-1,2-diamine |
| SMILES | COc1ccc2nc(-c3ccc(N4CC(OC5CCN(CCNCCN)CC5)C4)cc3)sc2c1 |
| InChI | InChI=1S/C26H35N5O2S/c1-32-22-6-7-24-25(16-22)34-26(29-24)19-2-4-20(5-3-19)31-17-23(18-31)33-21-8-13-30(14-9-21)15-12-28-11-10-27/h2-7,16,21,23,28H,8-15,17-18,27H2,1H3 |
| InChIKey | NSAGGQAQXGOFOA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|