C37H40N6O6S — CID 146420301
2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[4-[3-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypropyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 146420301) has the molecular formula C37H40N6O6S and a molecular weight of 696.83 g/mol. Its IUPAC name is 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[4-[3-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypropyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[4-[3-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypropyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146420301 |
| Molecular Formula | C37H40N6O6S |
| Molecular Weight | 696.83 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[4-[3-[1-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]azetidin-3-yl]oxypropyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc2nc(-c3ccc(N4CC(OCCCN5CCN(c6ccc7c(c6)C(=O)N(C6CCC(=O)NC6O)C7=O)CC5)C4)cc3)sc2c1 |
| InChI | InChI=1S/C37H40N6O6S/c1-48-26-8-10-30-32(20-26)50-35(38-30)23-3-5-24(6-4-23)42-21-27(22-42)49-18-2-13-40-14-16-41(17-15-40)25-7-9-28-29(19-25)37(47)43(36(28)46)31-11-12-33(44)39-34(31)45/h3-10,19-20,27,31,34,45H,2,11-18,21-22H2,1H3,(H,39,44) |
| InChIKey | AAXWJKATUVGPAQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|