C38H42BN5O5S — CID 153464008
5-[4-[3-[1-(3-benzo[b][1,4]benzothiaborinin-10-ylpropyl)azetidin-3-yl]oxypropyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 153464008) has the molecular formula C38H42BN5O5S and a molecular weight of 691.66 g/mol. Its IUPAC name is 5-[4-[3-[1-(3-benzo[b][1,4]benzothiaborinin-10-ylpropyl)azetidin-3-yl]oxypropyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[3-[1-(3-benzo[b][1,4]benzothiaborinin-10-ylpropyl)azetidin-3-yl]oxypropyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 153464008 |
| Molecular Formula | C38H42BN5O5S |
| Molecular Weight | 691.66 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | 5-[4-[3-[1-(3-benzo[b][1,4]benzothiaborinin-10-ylpropyl)azetidin-3-yl]oxypropyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CCCOC5CN(CCCB6c7ccccc7Sc7ccccc76)C5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C38H42BN5O5S/c45-35-14-13-32(36(46)40-35)44-37(47)28-12-11-26(23-29(28)38(44)48)43-20-18-41(19-21-43)17-6-22-49-27-24-42(25-27)16-5-15-39-30-7-1-3-9-33(30)50-34-10-4-2-8-31(34)39/h1-4,7-12,23,27,32H,5-6,13-22,24-25H2,(H,40,45,46) |
| InChIKey | LBQBYQLSBYIPGO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|