C23H29N3O7 — CID 134492958
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methoxypropoxy)propoxy]azetidin-1-yl]isoindole-1,3-dione (PubChem CID 134492958) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methoxypropoxy)propoxy]azetidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methoxypropoxy)propoxy]azetidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134492958 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methoxypropoxy)propoxy]azetidin-1-yl]isoindole-1,3-dione |
| SMILES | COCCCOCCCOC1CN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C23H29N3O7/c1-31-8-2-9-32-10-3-11-33-16-13-25(14-16)15-4-5-17-18(12-15)23(30)26(22(17)29)19-6-7-20(27)24-21(19)28/h4-5,12,16,19H,2-3,6-11,13-14H2,1H3,(H,24,27,28) |
| InChIKey | WFXDDMSLEKJLGM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|