C15H19ClFN3O — CID 135304233
(2R,3S)-2-[3-(7-chloro-4-fluorobenzimidazol-1-yl)propyl]piperidin-3-ol (PubChem CID 135304233) has the molecular formula C15H19ClFN3O and a molecular weight of 311.79 g/mol. Its IUPAC name is (2R,3S)-2-[3-(7-chloro-4-fluorobenzimidazol-1-yl)propyl]piperidin-3-ol.
| Compound Name | (2R,3S)-2-[3-(7-chloro-4-fluorobenzimidazol-1-yl)propyl]piperidin-3-ol |
|---|---|
| PubChem CID | 135304233 |
| Molecular Formula | C15H19ClFN3O |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R,3S)-2-[3-(7-chloro-4-fluorobenzimidazol-1-yl)propyl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN[C@@H]1CCCn1cnc2c(F)ccc(Cl)c21 |
| InChI | InChI=1S/C15H19ClFN3O/c16-10-5-6-11(17)14-15(10)20(9-19-14)8-2-3-12-13(21)4-1-7-18-12/h5-6,9,12-13,18,21H,1-4,7-8H2/t12-,13+/m1/s1 |
| InChIKey | VJZNLCBWXAXUIW-OLZOCXBDSA-N |
| XLogP | 2.72 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |