C28H28ClF3N4O3 — CID 135307043
(2S,4S)-1-[(2-chlorophenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-4-[[4-(trifluoromethyl)phenyl]methylamino]pyrrolidine-2-carboxamide (PubChem CID 135307043) has the molecular formula C28H28ClF3N4O3 and a molecular weight of 561.00 g/mol. Its IUPAC name is (2S,4S)-1-[(2-chlorophenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-4-[[4-(trifluoromethyl)phenyl]methylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2-chlorophenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-4-[[4-(trifluoromethyl)phenyl]methylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135307043 |
| Molecular Formula | C28H28ClF3N4O3 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | (2S,4S)-1-[(2-chlorophenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-4-[[4-(trifluoromethyl)phenyl]methylamino]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCc1ccc([N+](=O)[O-])cc1)[C@@H]1C[C@H](NCc2ccc(C(F)(F)F)cc2)CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C28H28ClF3N4O3/c29-25-4-2-1-3-21(25)17-35-18-23(34-16-20-5-9-22(10-6-20)28(30,31)32)15-26(35)27(37)33-14-13-19-7-11-24(12-8-19)36(38)39/h1-12,23,26,34H,13-18H2,(H,33,37)/t23-,26-/m0/s1 |
| InChIKey | ALKWQYXCSPYKKQ-OZXSUGGESA-N |
| XLogP | 5.36 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|