About 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate
1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 135307100) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
Molecular Properties
| Compound Name | 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| PubChem CID | 135307100 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CCCCC(O)OC(=O)N1CC2CC2(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C18H25NO4/c1-3-4-5-16(20)23-17(21)19-11-14-10-18(14,12-19)13-6-8-15(22-2)9-7-13/h6-9,14,16,20H,3-5,10-12H2,1-2H3 |
| InChIKey | ZPFFLXCHKMAETN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The IUPAC name of 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CID 135307100) is 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
What is the SMILES notation for 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The canonical SMILES for 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is CCCCC(O)OC(=O)N1CC2CC2(c2ccc(OC)cc2)C1.
What is the InChIKey of 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The InChIKey is ZPFFLXCHKMAETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4/c1-3-4-5-16(20)23-17(21)19-11-14-10-18(14,12-19)13-6-8-15(22-2)9-7-13/h6-9,14,16,20H,3-5,10-12H2,1-2H3.
What are the key properties of 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate has a molecular weight of 319.40 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypentyl 1-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is sourced from PubChem (CID 135307100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).