C9H12N2O4 — CID 135307972
[(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-yl]carbamic acid (PubChem CID 135307972) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is [(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-yl]carbamic acid.
| Compound Name | [(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 135307972 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | [(3R,6S)-6-(1,3-oxazol-5-yl)oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@@H](c2cnco2)OC1 |
| InChI | InChI=1S/C9H12N2O4/c12-9(13)11-6-1-2-7(14-4-6)8-3-10-5-15-8/h3,5-7,11H,1-2,4H2,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | BDJUKEDDXGMJCY-RQJHMYQMSA-N |
| XLogP | 1.16 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |