C32H37N3O3 — CID 135310506
methyl (E)-3-[3-[(4-aminocyclohexanecarbonyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 135310506) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is methyl (E)-3-[3-[(4-aminocyclohexanecarbonyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(4-aminocyclohexanecarbonyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135310506 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | methyl (E)-3-[3-[(4-aminocyclohexanecarbonyl)-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)C(=O)C2CCC(N)CC2)c1 |
| InChI | InChI=1S/C32H37N3O3/c1-34(2)29-18-14-26(15-19-29)25-10-7-24(8-11-25)22-35(32(37)27-12-16-28(33)17-13-27)30-6-4-5-23(21-30)9-20-31(36)38-3/h4-11,14-15,18-21,27-28H,12-13,16-17,22,33H2,1-3H3/b20-9+ |
| InChIKey | CPVSDSHHRZQIBR-AWQFTUOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|