C33H40N2O3 — CID 144922429
N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]-N-[3-[(E)-3-oxoprop-1-enyl]phenyl]cyclohexanecarboxamide;methoxymethane (PubChem CID 144922429) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]-N-[3-[(E)-3-oxoprop-1-enyl]phenyl]cyclohexanecarboxamide;methoxymethane.
| Compound Name | N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]-N-[3-[(E)-3-oxoprop-1-enyl]phenyl]cyclohexanecarboxamide;methoxymethane |
|---|---|
| PubChem CID | 144922429 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]-N-[3-[(E)-3-oxoprop-1-enyl]phenyl]cyclohexanecarboxamide;methoxymethane |
| SMILES | CN(C)c1ccc(-c2ccc(CN(C(=O)C3CCCCC3)c3cccc(/C=C/C=O)c3)cc2)cc1.COC |
| InChI | InChI=1S/C31H34N2O2.C2H6O/c1-32(2)29-19-17-27(18-20-29)26-15-13-25(14-16-26)23-33(31(35)28-10-4-3-5-11-28)30-12-6-8-24(22-30)9-7-21-34;1-3-2/h6-9,12-22,28H,3-5,10-11,23H2,1-2H3;1-2H3/b9-7+; |
| InChIKey | NJDSNAPMZUVFSL-BXTVWIJMSA-N |
| XLogP | 7.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|