C33H42ClN3O — CID 126696434
N-[3-[(4-chlorobutylamino)methyl]phenyl]-N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarboxamide (PubChem CID 126696434) has the molecular formula C33H42ClN3O and a molecular weight of 532.17 g/mol. Its IUPAC name is N-[3-[(4-chlorobutylamino)methyl]phenyl]-N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[(4-chlorobutylamino)methyl]phenyl]-N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 126696434 |
| Molecular Formula | C33H42ClN3O |
| Molecular Weight | 532.17 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | N-[3-[(4-chlorobutylamino)methyl]phenyl]-N-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]cyclohexanecarboxamide |
| SMILES | CN(C)c1ccc(-c2ccc(CN(C(=O)C3CCCCC3)c3cccc(CNCCCCCl)c3)cc2)cc1 |
| InChI | InChI=1S/C33H42ClN3O/c1-36(2)31-19-17-29(18-20-31)28-15-13-26(14-16-28)25-37(33(38)30-10-4-3-5-11-30)32-12-8-9-27(23-32)24-35-22-7-6-21-34/h8-9,12-20,23,30,35H,3-7,10-11,21-22,24-25H2,1-2H3 |
| InChIKey | ARRFEUBFOKEDGA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.17 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|