C33H38N2O3 — CID 126717096
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]but-2-enoate (PubChem CID 126717096) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]but-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 126717096 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(dimethylamino)phenyl]phenyl]methyl]amino]phenyl]but-2-enoate |
| SMILES | COC(=O)/C=C(\C)c1cccc(N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C33H38N2O3/c1-24(21-32(36)38-4)29-11-8-12-31(22-29)35(33(37)28-9-6-5-7-10-28)23-25-13-15-26(16-14-25)27-17-19-30(20-18-27)34(2)3/h8,11-22,28H,5-7,9-10,23H2,1-4H3/b24-21+ |
| InChIKey | UOJDSHUIJOGWAE-DARPEHSRSA-N |
| XLogP | 7.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|