C33H46N2O2 — CID 135311596
4-[(3R,5R,10S,13R)-10,13-dimethyl-3-(quinolin-2-ylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 135311596) has the molecular formula C33H46N2O2 and a molecular weight of 502.74 g/mol. Its IUPAC name is 4-[(3R,5R,10S,13R)-10,13-dimethyl-3-(quinolin-2-ylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | 4-[(3R,5R,10S,13R)-10,13-dimethyl-3-(quinolin-2-ylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 135311596 |
| Molecular Formula | C33H46N2O2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.36 |
| IUPAC Name | 4-[(3R,5R,10S,13R)-10,13-dimethyl-3-(quinolin-2-ylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC(CCC(=O)O)C1CCC2C3CC[C@@H]4C[C@H](Nc5ccc6ccccc6n5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C33H46N2O2/c1-21(8-15-31(36)37)26-12-13-27-25-11-10-23-20-24(16-18-32(23,2)28(25)17-19-33(26,27)3)34-30-14-9-22-6-4-5-7-29(22)35-30/h4-7,9,14,21,23-28H,8,10-13,15-20H2,1-3H3,(H,34,35)(H,36,37)/t21?,23-,24-,25?,26?,27?,28?,32+,33-/m1/s1 |
| InChIKey | HYDORHBTJOYTEH-OZIYIZLTSA-N |
| XLogP | 8.18 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |