C19H19BrO3 — CID 135313696
1-[(4-bromo-3-phenylmethoxyphenyl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 135313696) has the molecular formula C19H19BrO3 and a molecular weight of 375.26 g/mol. Its IUPAC name is 1-[(4-bromo-3-phenylmethoxyphenyl)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(4-bromo-3-phenylmethoxyphenyl)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 135313696 |
| Molecular Formula | C19H19BrO3 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1-[(4-bromo-3-phenylmethoxyphenyl)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Br)c(OCc3ccccc3)c2)CCC1 |
| InChI | InChI=1S/C19H19BrO3/c20-16-8-7-15(12-19(18(21)22)9-4-10-19)11-17(16)23-13-14-5-2-1-3-6-14/h1-3,5-8,11H,4,9-10,12-13H2,(H,21,22) |
| InChIKey | GDVLRDXWLYKNSZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |