C7H8F3N3O3 — CID 135314210
2H-pyrimidine-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 135314210) has the molecular formula C7H8F3N3O3 and a molecular weight of 239.15 g/mol. Its IUPAC name is 2H-pyrimidine-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2H-pyrimidine-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135314210 |
| Molecular Formula | C7H8F3N3O3 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2H-pyrimidine-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)N1C=CC=NC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H7N3O.C2HF3O2/c6-5(9)8-3-1-2-7-4-8;3-2(4,5)1(6)7/h1-3H,4H2,(H2,6,9);(H,6,7) |
| InChIKey | BLZQRVJOAUEYOP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |