C30H35N5O2 — CID 135314394
3-[[[(E)-4-(pyridin-3-ylmethylamino)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 135314394) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-[[[(E)-4-(pyridin-3-ylmethylamino)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 3-[[[(E)-4-(pyridin-3-ylmethylamino)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 135314394 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 3-[[[(E)-4-(pyridin-3-ylmethylamino)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | O=C(O)N1Cc2ccccc2CC1CN(C/C=C/CNCc1cccnc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C30H35N5O2/c36-30(37)35-21-26-10-2-1-9-25(26)18-27(35)22-34(28-13-5-11-24-12-7-16-33-29(24)28)17-4-3-14-31-19-23-8-6-15-32-20-23/h1-4,6-10,12,15-16,20,27-28,31H,5,11,13-14,17-19,21-22H2,(H,36,37)/b4-3+ |
| InChIKey | GWZCEVKXLYLZOL-ONEGZZNKSA-N |
| XLogP | 4.61 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|