C32H45N3 — CID 159234659
(E)-N-(4,4-dimethylcyclohexyl)-N'-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]but-2-ene-1,4-diamine (PubChem CID 159234659) has the molecular formula C32H45N3 and a molecular weight of 471.73 g/mol. Its IUPAC name is (E)-N-(4,4-dimethylcyclohexyl)-N'-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]but-2-ene-1,4-diamine.
| Compound Name | (E)-N-(4,4-dimethylcyclohexyl)-N'-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 159234659 |
| Molecular Formula | C32H45N3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.36 |
| IUPAC Name | (E)-N-(4,4-dimethylcyclohexyl)-N'-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]but-2-ene-1,4-diamine |
| SMILES | CC1(C)CCC(NC/C=C/CN(C[C@@H]2CCc3ccccc3C2)[C@H]2CCCc3cccnc32)CC1 |
| InChI | InChI=1S/C32H45N3/c1-32(2)18-16-29(17-19-32)33-20-5-6-22-35(30-13-7-11-27-12-8-21-34-31(27)30)24-25-14-15-26-9-3-4-10-28(26)23-25/h3-6,8-10,12,21,25,29-30,33H,7,11,13-20,22-24H2,1-2H3/b6-5+/t25-,30+/m1/s1 |
| InChIKey | KTIAKUOVAUQYOO-MWBKIKNYSA-N |
| XLogP | 6.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|