C27H32N4 — CID 135314388
(8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 135314388) has the molecular formula C27H32N4 and a molecular weight of 412.58 g/mol. Its IUPAC name is (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 135314388 |
| Molecular Formula | C27H32N4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-[[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | NCc1ccc(CN(C[C@H]2Cc3ccccc3CN2)[C@H]2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C27H32N4/c28-16-20-10-12-21(13-11-20)18-31(26-9-3-7-22-8-4-14-29-27(22)26)19-25-15-23-5-1-2-6-24(23)17-30-25/h1-2,4-6,8,10-14,25-26,30H,3,7,9,15-19,28H2/t25-,26+/m1/s1 |
| InChIKey | MCTNGARCDMPDNT-FTJBHMTQSA-N |
| XLogP | 4.13 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |