C31H45N5O — CID 166488267
(8S)-N-[[(3R)-5-morpholin-4-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-(3-piperidin-4-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 166488267) has the molecular formula C31H45N5O and a molecular weight of 503.74 g/mol. Its IUPAC name is (8S)-N-[[(3R)-5-morpholin-4-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-(3-piperidin-4-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[(3R)-5-morpholin-4-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-(3-piperidin-4-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 166488267 |
| Molecular Formula | C31H45N5O |
| Molecular Weight | 503.74 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | (8S)-N-[[(3R)-5-morpholin-4-yl-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-(3-piperidin-4-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | c1cnc2c(c1)CCC[C@@H]2N(CCCC1CCNCC1)C[C@H]1Cc2c(cccc2N2CCOCC2)CN1 |
| InChI | InChI=1S/C31H45N5O/c1-6-25-8-3-13-33-31(25)30(10-1)36(16-4-5-24-11-14-32-15-12-24)23-27-21-28-26(22-34-27)7-2-9-29(28)35-17-19-37-20-18-35/h2-3,7-9,13,24,27,30,32,34H,1,4-6,10-12,14-23H2/t27-,30+/m1/s1 |
| InChIKey | IIWAGMUZBNNXEA-OFSOJUDTSA-N |
| XLogP | 4.09 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |