C26H37N5 — CID 146398898
(8S)-N-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 146398898) has the molecular formula C26H37N5 and a molecular weight of 419.62 g/mol. Its IUPAC name is (8S)-N-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 146398898 |
| Molecular Formula | C26H37N5 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (8S)-N-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C[C@@H]1CN(c2cccc3c2CC(CN(C)[C@H]2CCCc4cccnc42)NC3)C[C@H](C)N1 |
| InChI | InChI=1S/C26H37N5/c1-18-15-31(16-19(2)29-18)24-10-5-8-21-14-28-22(13-23(21)24)17-30(3)25-11-4-7-20-9-6-12-27-26(20)25/h5-6,8-10,12,18-19,22,25,28-29H,4,7,11,13-17H2,1-3H3/t18-,19+,22?,25-/m0/s1 |
| InChIKey | JHHVTZUPBAYGDQ-JOAXTPTHSA-N |
| XLogP | 3.29 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |