C25H35N5O — CID 146398829
2-(dimethylamino)-N-[[(3S)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]acetamide (PubChem CID 146398829) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[[(3S)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[[(3S)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 146398829 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-(dimethylamino)-N-[[(3S)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]acetamide |
| SMILES | CN(C)CC(=O)NCc1cccc2c1C[C@@H](CN(C)[C@H]1CCCc3cccnc31)NC2 |
| InChI | InChI=1S/C25H35N5O/c1-29(2)17-24(31)28-15-20-9-4-8-19-14-27-21(13-22(19)20)16-30(3)23-11-5-7-18-10-6-12-26-25(18)23/h4,6,8-10,12,21,23,27H,5,7,11,13-17H2,1-3H3,(H,28,31)/t21-,23-/m0/s1 |
| InChIKey | TVWUGJROAFZYND-GMAHTHKFSA-N |
| XLogP | 2.28 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |