C26H37N5 — CID 157300669
(8S)-N-methyl-N-[[(3S)-5-[(4-methylpiperazin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 157300669) has the molecular formula C26H37N5 and a molecular weight of 419.62 g/mol. Its IUPAC name is (8S)-N-methyl-N-[[(3S)-5-[(4-methylpiperazin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-methyl-N-[[(3S)-5-[(4-methylpiperazin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 157300669 |
| Molecular Formula | C26H37N5 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (8S)-N-methyl-N-[[(3S)-5-[(4-methylpiperazin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CN1CCN(Cc2cccc3c2C[C@@H](CN(C)[C@H]2CCCc4cccnc42)NC3)CC1 |
| InChI | InChI=1S/C26H37N5/c1-29-12-14-31(15-13-29)18-22-8-3-7-21-17-28-23(16-24(21)22)19-30(2)25-10-4-6-20-9-5-11-27-26(20)25/h3,5,7-9,11,23,25,28H,4,6,10,12-19H2,1-2H3/t23-,25-/m0/s1 |
| InChIKey | SDLCLLCRYAYXKB-ZCYQVOJMSA-N |
| XLogP | 2.85 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |