C26H35N5O2 — CID 146398902
N-[(3R)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-2-morpholin-4-ylacetamide (PubChem CID 146398902) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[(3R)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(3R)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 146398902 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | N-[(3R)-3-[[methyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-2-morpholin-4-ylacetamide |
| SMILES | CN(C[C@H]1Cc2c(cccc2NC(=O)CN2CCOCC2)CN1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C26H35N5O2/c1-30(24-9-3-5-19-7-4-10-27-26(19)24)17-21-15-22-20(16-28-21)6-2-8-23(22)29-25(32)18-31-11-13-33-14-12-31/h2,4,6-8,10,21,24,28H,3,5,9,11-18H2,1H3,(H,29,32)/t21-,24+/m1/s1 |
| InChIKey | GQRUTZFUQWILPX-QPPBQGQZSA-N |
| XLogP | 2.38 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |