C26H34N6O2 — CID 11554442
2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-(3-morpholin-4-ylpropyl)-1H-benzimidazole-4-carboxamide (PubChem CID 11554442) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-(3-morpholin-4-ylpropyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-(3-morpholin-4-ylpropyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11554442 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-(3-morpholin-4-ylpropyl)-1H-benzimidazole-4-carboxamide |
| SMILES | CN(Cc1nc2c(C(=O)NCCCN3CCOCC3)cccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C26H34N6O2/c1-31(22-10-2-6-19-7-4-11-27-24(19)22)18-23-29-21-9-3-8-20(25(21)30-23)26(33)28-12-5-13-32-14-16-34-17-15-32/h3-4,7-9,11,22H,2,5-6,10,12-18H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | KZZCKGOROMDOGS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|