C26H31N5 — CID 146398434
(8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-(5,6,7,8-tetrahydro-1,6-naphthyridin-7-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 146398434) has the molecular formula C26H31N5 and a molecular weight of 413.57 g/mol. Its IUPAC name is (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-(5,6,7,8-tetrahydro-1,6-naphthyridin-7-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-(5,6,7,8-tetrahydro-1,6-naphthyridin-7-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 146398434 |
| Molecular Formula | C26H31N5 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (8S)-N-[[4-(aminomethyl)phenyl]methyl]-N-(5,6,7,8-tetrahydro-1,6-naphthyridin-7-ylmethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | NCc1ccc(CN(CC2Cc3ncccc3CN2)[C@H]2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C26H31N5/c27-15-19-8-10-20(11-9-19)17-31(25-7-1-4-21-5-2-13-29-26(21)25)18-23-14-24-22(16-30-23)6-3-12-28-24/h2-3,5-6,8-13,23,25,30H,1,4,7,14-18,27H2/t23?,25-/m0/s1 |
| InChIKey | CWTRQVADIKYVDE-YNMFNDETSA-N |
| XLogP | 3.53 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |