C18H18ClFN6O3S2 — CID 135316794
(3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methyl-1,2,4-triazol-3-yl)thiophen-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135316794) has the molecular formula C18H18ClFN6O3S2 and a molecular weight of 484.97 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methyl-1,2,4-triazol-3-yl)thiophen-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methyl-1,2,4-triazol-3-yl)thiophen-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135316794 |
| Molecular Formula | C18H18ClFN6O3S2 |
| Molecular Weight | 484.97 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methyl-1,2,4-triazol-3-yl)thiophen-2-yl]-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2cc(-c3ncn(C)n3)cs2)NS1(=O)=O |
| InChI | InChI=1S/C18H18ClFN6O3S2/c1-25-9-21-17(23-25)10-5-16(30-8-10)14-7-15(26(2)31(28,29)24-14)18(27)22-11-3-4-13(20)12(19)6-11/h3-6,8-9,14-15,24H,7H2,1-2H3,(H,22,27)/t14-,15+/m1/s1 |
| InChIKey | BWLHPFCKHOIOTA-CABCVRRESA-N |
| XLogP | 2.55 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.97 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |