C20H17ClF2N4O3S2 — CID 135317195
(3S,5R)-N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317195) has the molecular formula C20H17ClF2N4O3S2 and a molecular weight of 498.96 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317195 |
| Molecular Formula | C20H17ClF2N4O3S2 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2ncc(-c3ccc(F)cc3)s2)NS1(=O)=O |
| InChI | InChI=1S/C20H17ClF2N4O3S2/c1-27-17(19(28)25-13-6-7-15(23)14(21)8-13)9-16(26-32(27,29)30)20-24-10-18(31-20)11-2-4-12(22)5-3-11/h2-8,10,16-17,26H,9H2,1H3,(H,25,28)/t16-,17+/m1/s1 |
| InChIKey | FYJZDFVXOHAIKQ-SJORKVTESA-N |
| XLogP | 3.96 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |