C15H20BrN3O — CID 135317505
(1R,3S,5R)-N-(6-bromo-4-propyl-2-pyridinyl)-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 135317505) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is (1R,3S,5R)-N-(6-bromo-4-propyl-2-pyridinyl)-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-N-(6-bromo-4-propyl-2-pyridinyl)-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 135317505 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (1R,3S,5R)-N-(6-bromo-4-propyl-2-pyridinyl)-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CCCc1cc(Br)nc(NC(=O)[C@@H]2C[C@@]3(C)C[C@H]3N2)c1 |
| InChI | InChI=1S/C15H20BrN3O/c1-3-4-9-5-12(16)18-13(6-9)19-14(20)10-7-15(2)8-11(15)17-10/h5-6,10-11,17H,3-4,7-8H2,1-2H3,(H,18,19,20)/t10-,11+,15-/m0/s1 |
| InChIKey | HKDJOGNQGUUJNJ-RWSFTLGLSA-N |
| XLogP | 2.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|