C17H23ClN4O2 — CID 166696969
(3S,5R)-N-[6-chloro-3-(morpholin-4-ylmethyl)-2-pyridinyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 166696969) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is (3S,5R)-N-[6-chloro-3-(morpholin-4-ylmethyl)-2-pyridinyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (3S,5R)-N-[6-chloro-3-(morpholin-4-ylmethyl)-2-pyridinyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 166696969 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3S,5R)-N-[6-chloro-3-(morpholin-4-ylmethyl)-2-pyridinyl]-5-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C[C@]12CC1N[C@H](C(=O)Nc1nc(Cl)ccc1CN1CCOCC1)C2 |
| InChI | InChI=1S/C17H23ClN4O2/c1-17-8-12(19-13(17)9-17)16(23)21-15-11(2-3-14(18)20-15)10-22-4-6-24-7-5-22/h2-3,12-13,19H,4-10H2,1H3,(H,20,21,23)/t12-,13?,17-/m0/s1 |
| InChIKey | DISJJYRBTZSJDM-NKGYKZILSA-N |
| XLogP | 1.65 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|