C21H30N4O4 — CID 135318596
5-N-(3,3-diethoxypropyl)-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide (PubChem CID 135318596) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-N-(3,3-diethoxypropyl)-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-(3,3-diethoxypropyl)-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 135318596 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 5-N-(3,3-diethoxypropyl)-3-N-methyl-1-[(1S)-1-phenylethyl]pyrazole-3,5-dicarboxamide |
| SMILES | CCOC(CCNC(=O)c1cc(C(=O)NC)nn1[C@@H](C)c1ccccc1)OCC |
| InChI | InChI=1S/C21H30N4O4/c1-5-28-19(29-6-2)12-13-23-21(27)18-14-17(20(26)22-4)24-25(18)15(3)16-10-8-7-9-11-16/h7-11,14-15,19H,5-6,12-13H2,1-4H3,(H,22,26)(H,23,27)/t15-/m0/s1 |
| InChIKey | QWQQRPRXDUFPNB-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|